C12H20NO+ — CID 3420531
1-methyl-1-azoniatricyclo[6.2.2.02,7]dodec-6-en-5-ol (PubChem CID 3420531) has the molecular formula C12H20NO+ and a molecular weight of 194.30 g/mol. Its IUPAC name is 1-methyl-1-azoniatricyclo[6.2.2.02,7]dodec-6-en-5-ol.
| Compound Name | 1-methyl-1-azoniatricyclo[6.2.2.02,7]dodec-6-en-5-ol |
|---|---|
| PubChem CID | 3420531 |
| Molecular Formula | C12H20NO+ |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1-methyl-1-azoniatricyclo[6.2.2.02,7]dodec-6-en-5-ol |
| SMILES | C[N+]12CCC(CC1)C1=CC(O)CCC12 |
| InChI | InChI=1S/C12H20NO/c1-13-6-4-9(5-7-13)11-8-10(14)2-3-12(11)13/h8-10,12,14H,2-7H2,1H3/q+1 |
| InChIKey | YKFILFDJENPVBD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|