C23H23NO6S — CID 34238914
[4-[(E)-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2,5-dimethylbenzenesulfonate (PubChem CID 34238914) has the molecular formula C23H23NO6S and a molecular weight of 441.51 g/mol. Its IUPAC name is [4-[(E)-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2,5-dimethylbenzenesulfonate.
| Compound Name | [4-[(E)-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 34238914 |
| Molecular Formula | C23H23NO6S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | [4-[(E)-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2,5-dimethylbenzenesulfonate |
| SMILES | COc1cc(/C=C/C(=O)NCc2ccco2)ccc1OS(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C23H23NO6S/c1-16-6-7-17(2)22(13-16)31(26,27)30-20-10-8-18(14-21(20)28-3)9-11-23(25)24-15-19-5-4-12-29-19/h4-14H,15H2,1-3H3,(H,24,25)/b11-9+ |
| InChIKey | IGHRCFWSYWKTCN-PKNBQFBNSA-N |
| XLogP | 4.00 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|