C24H29NO7S — CID 55324070
[2-(tert-butylamino)-2-oxoethyl] (E)-3-[4-(2,5-dimethylphenyl)sulfonyloxy-3-methoxyphenyl]prop-2-enoate (PubChem CID 55324070) has the molecular formula C24H29NO7S and a molecular weight of 475.56 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] (E)-3-[4-(2,5-dimethylphenyl)sulfonyloxy-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] (E)-3-[4-(2,5-dimethylphenyl)sulfonyloxy-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55324070 |
| Molecular Formula | C24H29NO7S |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] (E)-3-[4-(2,5-dimethylphenyl)sulfonyloxy-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)NC(C)(C)C)ccc1OS(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C24H29NO7S/c1-16-7-8-17(2)21(13-16)33(28,29)32-19-11-9-18(14-20(19)30-6)10-12-23(27)31-15-22(26)25-24(3,4)5/h7-14H,15H2,1-6H3,(H,25,26)/b12-10+ |
| InChIKey | YTXUEIIJGXNOPP-ZRDIBKRKSA-N |
| XLogP | 3.55 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|