C25H33N5O5 — CID 34250924
3,4,5-triethoxy-N'-[3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoyl]benzohydrazide (PubChem CID 34250924) has the molecular formula C25H33N5O5 and a molecular weight of 483.57 g/mol. Its IUPAC name is 3,4,5-triethoxy-N'-[3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoyl]benzohydrazide.
| Compound Name | 3,4,5-triethoxy-N'-[3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 34250924 |
| Molecular Formula | C25H33N5O5 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 3,4,5-triethoxy-N'-[3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoyl]benzohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)CCc2c(C)nc3cc(C)nn3c2C)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H33N5O5/c1-7-33-20-13-18(14-21(34-8-2)24(20)35-9-3)25(32)28-27-23(31)11-10-19-16(5)26-22-12-15(4)29-30(22)17(19)6/h12-14H,7-11H2,1-6H3,(H,27,31)(H,28,32) |
| InChIKey | LFBNBIQHHUUNHK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|