C21H13Cl2NO4S3 — CID 34257831
[2-methoxy-4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3,4-dichloro-1-benzothiophene-2-carboxylate (PubChem CID 34257831) has the molecular formula C21H13Cl2NO4S3 and a molecular weight of 510.45 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3,4-dichloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-methoxy-4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3,4-dichloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 34257831 |
| Molecular Formula | C21H13Cl2NO4S3 |
| Molecular Weight | 510.45 g/mol |
| Exact Mass | 508.94 |
| IUPAC Name | [2-methoxy-4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3,4-dichloro-1-benzothiophene-2-carboxylate |
| SMILES | COc1cc(/C=C2\SC(=S)N(C)C2=O)ccc1OC(=O)c1sc2cccc(Cl)c2c1Cl |
| InChI | InChI=1S/C21H13Cl2NO4S3/c1-24-19(25)15(31-21(24)29)9-10-6-7-12(13(8-10)27-2)28-20(26)18-17(23)16-11(22)4-3-5-14(16)30-18/h3-9H,1-2H3/b15-9- |
| InChIKey | JGIOOWPDMJNHKL-DHDCSXOGSA-N |
| XLogP | 6.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.45 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|