C20H16ClF3N4O3S — CID 34275124
[4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-quinoxalin-2-ylmethanone (PubChem CID 34275124) has the molecular formula C20H16ClF3N4O3S and a molecular weight of 484.89 g/mol. Its IUPAC name is [4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-quinoxalin-2-ylmethanone.
| Compound Name | [4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-quinoxalin-2-ylmethanone |
|---|---|
| PubChem CID | 34275124 |
| Molecular Formula | C20H16ClF3N4O3S |
| Molecular Weight | 484.89 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | [4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-quinoxalin-2-ylmethanone |
| SMILES | O=C(c1cnc2ccccc2n1)N1CCN(S(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H16ClF3N4O3S/c21-15-6-5-13(11-14(15)20(22,23)24)32(30,31)28-9-7-27(8-10-28)19(29)18-12-25-16-3-1-2-4-17(16)26-18/h1-6,11-12H,7-10H2 |
| InChIKey | JPTBDIQRYOFTLC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.89 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |