C35H32N4O7 — CID 3428632
6-(2-hydroxy-6-methoxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide (PubChem CID 3428632) has the molecular formula C35H32N4O7 and a molecular weight of 620.66 g/mol. Its IUPAC name is 6-(2-hydroxy-6-methoxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide.
| Compound Name | 6-(2-hydroxy-6-methoxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide |
|---|---|
| PubChem CID | 3428632 |
| Molecular Formula | C35H32N4O7 |
| Molecular Weight | 620.66 g/mol |
| Exact Mass | 620.23 |
| IUPAC Name | 6-(2-hydroxy-6-methoxyphenyl)-8-(4-methylanilino)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide |
| SMILES | COc1cccc(O)c1C1C2=CCC3C(=O)N(C(N)=O)C(=O)C3C2CC2C(=O)N(Nc3ccc(C)cc3)C(=O)C21c1ccccc1 |
| InChI | InChI=1S/C35H32N4O7/c1-18-11-13-20(14-12-18)37-39-31(42)24-17-23-21(15-16-22-27(23)32(43)38(30(22)41)34(36)45)29(28-25(40)9-6-10-26(28)46-2)35(24,33(39)44)19-7-4-3-5-8-19/h3-15,22-24,27,29,37,40H,16-17H2,1-2H3,(H2,36,45) |
| InChIKey | BDSAACGIOKERDF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 159.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.66 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|