C23H14Cl2N2O3 — CID 3430707
(6-oxo-1,2-diphenylpyrimidin-4-yl) 2,4-dichlorobenzoate (PubChem CID 3430707) has the molecular formula C23H14Cl2N2O3 and a molecular weight of 437.28 g/mol. Its IUPAC name is (6-oxo-1,2-diphenylpyrimidin-4-yl) 2,4-dichlorobenzoate.
| Compound Name | (6-oxo-1,2-diphenylpyrimidin-4-yl) 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 3430707 |
| Molecular Formula | C23H14Cl2N2O3 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | (6-oxo-1,2-diphenylpyrimidin-4-yl) 2,4-dichlorobenzoate |
| SMILES | O=C(Oc1cc(=O)n(-c2ccccc2)c(-c2ccccc2)n1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H14Cl2N2O3/c24-16-11-12-18(19(25)13-16)23(29)30-20-14-21(28)27(17-9-5-2-6-10-17)22(26-20)15-7-3-1-4-8-15/h1-14H |
| InChIKey | VQCSMWDOELYAGY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |