C22H28BrNO4S — CID 34318143
ethyl 2-[[(1R,2R,4S)-2-bromo-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 34318143) has the molecular formula C22H28BrNO4S and a molecular weight of 482.44 g/mol. Its IUPAC name is ethyl 2-[[(1R,2R,4S)-2-bromo-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(1R,2R,4S)-2-bromo-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 34318143 |
| Molecular Formula | C22H28BrNO4S |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | ethyl 2-[[(1R,2R,4S)-2-bromo-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)[C@]23CC[C@](C)(C(=O)[C@@H]2Br)C3(C)C)sc2c1CCCC2 |
| InChI | InChI=1S/C22H28BrNO4S/c1-5-28-18(26)14-12-8-6-7-9-13(12)29-17(14)24-19(27)22-11-10-21(4,20(22,2)3)16(25)15(22)23/h15H,5-11H2,1-4H3,(H,24,27)/t15-,21+,22-/m0/s1 |
| InChIKey | NARMTDWMZCBEES-ARBPTSGCSA-N |
| XLogP | 4.90 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_C(7)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|