C23H24N2O2S — CID 3432237
N-(2-ethoxyphenyl)-2-(3-methylsulfanylanilino)-2-phenylacetamide (PubChem CID 3432237) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-2-(3-methylsulfanylanilino)-2-phenylacetamide.
| Compound Name | N-(2-ethoxyphenyl)-2-(3-methylsulfanylanilino)-2-phenylacetamide |
|---|---|
| PubChem CID | 3432237 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-(2-ethoxyphenyl)-2-(3-methylsulfanylanilino)-2-phenylacetamide |
| SMILES | CCOc1ccccc1NC(=O)C(Nc1cccc(SC)c1)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O2S/c1-3-27-21-15-8-7-14-20(21)25-23(26)22(17-10-5-4-6-11-17)24-18-12-9-13-19(16-18)28-2/h4-16,22,24H,3H2,1-2H3,(H,25,26) |
| InChIKey | NJTLGOHEPLPOQM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |