C18H21NO2 — CID 3436838
2-(2,5-dimethoxyphenyl)-4,7-dimethyl-2,3-dihydro-1H-indole (PubChem CID 3436838) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-4,7-dimethyl-2,3-dihydro-1H-indole.
| Compound Name | 2-(2,5-dimethoxyphenyl)-4,7-dimethyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 3436838 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-4,7-dimethyl-2,3-dihydro-1H-indole |
| SMILES | COc1ccc(OC)c(C2Cc3c(C)ccc(C)c3N2)c1 |
| InChI | InChI=1S/C18H21NO2/c1-11-5-6-12(2)18-14(11)10-16(19-18)15-9-13(20-3)7-8-17(15)21-4/h5-9,16,19H,10H2,1-4H3 |
| InChIKey | UPAJKMJFDOFDLK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |