C22H28N2O5 — CID 7243042
(NE)-N-[(2R,3R,6S)-2,6-bis(2,5-dimethoxyphenyl)-3-methylpiperidin-4-ylidene]hydroxylamine (PubChem CID 7243042) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is (NE)-N-[(2R,3R,6S)-2,6-bis(2,5-dimethoxyphenyl)-3-methylpiperidin-4-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2R,3R,6S)-2,6-bis(2,5-dimethoxyphenyl)-3-methylpiperidin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 7243042 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | (NE)-N-[(2R,3R,6S)-2,6-bis(2,5-dimethoxyphenyl)-3-methylpiperidin-4-ylidene]hydroxylamine |
| SMILES | COc1ccc(OC)c([C@@H]2C/C(=N\O)[C@H](C)[C@H](c3cc(OC)ccc3OC)N2)c1 |
| InChI | InChI=1S/C22H28N2O5/c1-13-18(24-25)12-19(16-10-14(26-2)6-8-20(16)28-4)23-22(13)17-11-15(27-3)7-9-21(17)29-5/h6-11,13,19,22-23,25H,12H2,1-5H3/b24-18+/t13-,19-,22+/m0/s1 |
| InChIKey | DGORHNKKUOXTDZ-FHGKDRAXSA-N |
| XLogP | 3.96 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|