C26H35NO5 — CID 51922150
(2R,3S,5S,6S)-2,6-bis(2,5-dimethoxyphenyl)-3,5-dimethyl-4-prop-2-enylpiperidin-4-ol (PubChem CID 51922150) has the molecular formula C26H35NO5 and a molecular weight of 441.57 g/mol. Its IUPAC name is (2R,3S,5S,6S)-2,6-bis(2,5-dimethoxyphenyl)-3,5-dimethyl-4-prop-2-enylpiperidin-4-ol.
| Compound Name | (2R,3S,5S,6S)-2,6-bis(2,5-dimethoxyphenyl)-3,5-dimethyl-4-prop-2-enylpiperidin-4-ol |
|---|---|
| PubChem CID | 51922150 |
| Molecular Formula | C26H35NO5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | (2R,3S,5S,6S)-2,6-bis(2,5-dimethoxyphenyl)-3,5-dimethyl-4-prop-2-enylpiperidin-4-ol |
| SMILES | C=CCC1(O)[C@@H](C)[C@@H](c2cc(OC)ccc2OC)N[C@@H](c2cc(OC)ccc2OC)[C@@H]1C |
| InChI | InChI=1S/C26H35NO5/c1-8-13-26(28)16(2)24(20-14-18(29-4)9-11-22(20)31-6)27-25(17(26)3)21-15-19(30-5)10-12-23(21)32-7/h8-12,14-17,24-25,27-28H,1,13H2,2-7H3/t16-,17-,24-,25+,26?/m0/s1 |
| InChIKey | BXFWZVIPUFEVJH-FTYXXKCGSA-N |
| XLogP | 4.69 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|