C19H16N2O3S — CID 3438491
4-methoxy-N-pyrrolo[1,2-a]quinolin-6-ylbenzenesulfonamide (PubChem CID 3438491) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is 4-methoxy-N-pyrrolo[1,2-a]quinolin-6-ylbenzenesulfonamide.
| Compound Name | 4-methoxy-N-pyrrolo[1,2-a]quinolin-6-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 3438491 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 4-methoxy-N-pyrrolo[1,2-a]quinolin-6-ylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cccc3c2ccc2cccn23)cc1 |
| InChI | InChI=1S/C19H16N2O3S/c1-24-15-8-10-16(11-9-15)25(22,23)20-18-5-2-6-19-17(18)12-7-14-4-3-13-21(14)19/h2-13,20H,1H3 |
| InChIKey | JNNISYCJILXBNI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |