C9H6O3S — CID 3440848
6-methoxy-1-benzothiophene-2,3-dione (PubChem CID 3440848) has the molecular formula C9H6O3S and a molecular weight of 194.21 g/mol. Its IUPAC name is 6-methoxy-1-benzothiophene-2,3-dione.
| Compound Name | 6-methoxy-1-benzothiophene-2,3-dione |
|---|---|
| PubChem CID | 3440848 |
| Molecular Formula | C9H6O3S |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | 6-methoxy-1-benzothiophene-2,3-dione |
| SMILES | COc1ccc2c(c1)SC(=O)C2=O |
| InChI | InChI=1S/C9H6O3S/c1-12-5-2-3-6-7(4-5)13-9(11)8(6)10/h2-4H,1H3 |
| InChIKey | ZOHKZLZEKUEPIR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|