C22H17N3OS — CID 3441646
N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-4-(dimethylamino)benzamide (PubChem CID 3441646) has the molecular formula C22H17N3OS and a molecular weight of 371.47 g/mol. Its IUPAC name is N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-4-(dimethylamino)benzamide.
| Compound Name | N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 3441646 |
| Molecular Formula | C22H17N3OS |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-4-(dimethylamino)benzamide |
| SMILES | CN(C)c1ccc(C(=O)Nc2nc3c(s2)-c2cccc4cccc-3c24)cc1 |
| InChI | InChI=1S/C22H17N3OS/c1-25(2)15-11-9-14(10-12-15)21(26)24-22-23-19-16-7-3-5-13-6-4-8-17(18(13)16)20(19)27-22/h3-12H,1-2H3,(H,23,24,26) |
| InChIKey | WDDJXXBDOODYLR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |