About N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-2-thiophen-2-ylacetamide
N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-2-thiophen-2-ylacetamide (PubChem CID 44919364) has the molecular formula C19H12N2OS2
and a molecular weight of 348.45 g/mol. Its IUPAC name is N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-2-thiophen-2-ylacetamide.
Molecular Properties
| Compound Name | N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-2-thiophen-2-ylacetamide |
| PubChem CID | 44919364 |
| Molecular Formula | C19H12N2OS2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1nc2c(s1)-c1cccc3cccc-2c13 |
| InChI | InChI=1S/C19H12N2OS2/c22-15(10-12-6-3-9-23-12)20-19-21-17-13-7-1-4-11-5-2-8-14(16(11)13)18(17)24-19/h1-9H,10H2,(H,20,21,22) |
| InChIKey | IMIQEHZTRSRBKL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|
Analyze N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-2-thiophen-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-2-thiophen-2-ylacetamide?
The IUPAC name of N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-2-thiophen-2-ylacetamide (CID 44919364) is N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-2-thiophen-2-ylacetamide.
What is the SMILES notation for N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-2-thiophen-2-ylacetamide?
The canonical SMILES for N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-2-thiophen-2-ylacetamide is O=C(Cc1cccs1)Nc1nc2c(s1)-c1cccc3cccc-2c13.
What is the InChIKey of N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-2-thiophen-2-ylacetamide?
The InChIKey is IMIQEHZTRSRBKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12N2OS2/c22-15(10-12-6-3-9-23-12)20-19-21-17-13-7-1-4-11-5-2-8-14(16(11)13)18(17)24-19/h1-9H,10H2,(H,20,21,22).
What are the key properties of N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-2-thiophen-2-ylacetamide?
N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-2-thiophen-2-ylacetamide has a molecular weight of 348.45 g/mol, XLogP of 5.19, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-2-thiophen-2-ylacetamide is sourced from PubChem (CID 44919364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).