C22H16N2O3S — CID 3600880
N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-2,4-dimethoxybenzamide (PubChem CID 3600880) has the molecular formula C22H16N2O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-2,4-dimethoxybenzamide.
| Compound Name | N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 3600880 |
| Molecular Formula | C22H16N2O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-acenaphthyleno[1,2-d][1,3]thiazol-8-yl-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2nc3c(s2)-c2cccc4cccc-3c24)c(OC)c1 |
| InChI | InChI=1S/C22H16N2O3S/c1-26-13-9-10-14(17(11-13)27-2)21(25)24-22-23-19-15-7-3-5-12-6-4-8-16(18(12)15)20(19)28-22/h3-11H,1-2H3,(H,23,24,25) |
| InChIKey | RVPJMURZOWDEJM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |