C21H22N4O5 — CID 3443916
2-[1-amino-2-(4-hydroxyphenyl)ethyl]-N-methyl-N-[2-(4-nitrophenyl)ethyl]-1,3-oxazole-4-carboxamide (PubChem CID 3443916) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-[1-amino-2-(4-hydroxyphenyl)ethyl]-N-methyl-N-[2-(4-nitrophenyl)ethyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[1-amino-2-(4-hydroxyphenyl)ethyl]-N-methyl-N-[2-(4-nitrophenyl)ethyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3443916 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-[1-amino-2-(4-hydroxyphenyl)ethyl]-N-methyl-N-[2-(4-nitrophenyl)ethyl]-1,3-oxazole-4-carboxamide |
| SMILES | CN(CCc1ccc([N+](=O)[O-])cc1)C(=O)c1coc(C(N)Cc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C21H22N4O5/c1-24(11-10-14-2-6-16(7-3-14)25(28)29)21(27)19-13-30-20(23-19)18(22)12-15-4-8-17(26)9-5-15/h2-9,13,18,26H,10-12,22H2,1H3 |
| InChIKey | WSRHHZPCIIJAPV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 135.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|