C20H23N3O3 — CID 34444534
(E)-3-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]-N-(6-morpholin-4-yl-3-pyridinyl)prop-2-enamide (PubChem CID 34444534) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is (E)-3-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]-N-(6-morpholin-4-yl-3-pyridinyl)prop-2-enamide.
| Compound Name | (E)-3-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]-N-(6-morpholin-4-yl-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 34444534 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (E)-3-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]-N-(6-morpholin-4-yl-3-pyridinyl)prop-2-enamide |
| SMILES | C[C@@H]1C[C@H]1c1ccc(/C=C/C(=O)Nc2ccc(N3CCOCC3)nc2)o1 |
| InChI | InChI=1S/C20H23N3O3/c1-14-12-17(14)18-5-3-16(26-18)4-7-20(24)22-15-2-6-19(21-13-15)23-8-10-25-11-9-23/h2-7,13-14,17H,8-12H2,1H3,(H,22,24)/b7-4+/t14-,17-/m1/s1 |
| InChIKey | YUCIRERJNPCPIM-GKXYRXCGSA-N |
| XLogP | 3.29 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|