C13H12N3O2+ — CID 3447639
3-hydroxy-2-pyridin-1-ium-3-yl-1,2-dihydroquinazolin-4-one (PubChem CID 3447639) has the molecular formula C13H12N3O2+ and a molecular weight of 242.26 g/mol. Its IUPAC name is 3-hydroxy-2-pyridin-1-ium-3-yl-1,2-dihydroquinazolin-4-one.
| Compound Name | 3-hydroxy-2-pyridin-1-ium-3-yl-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 3447639 |
| Molecular Formula | C13H12N3O2+ |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 3-hydroxy-2-pyridin-1-ium-3-yl-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2NC(c2ccc[nH+]c2)N1O |
| InChI | InChI=1S/C13H11N3O2/c17-13-10-5-1-2-6-11(10)15-12(16(13)18)9-4-3-7-14-8-9/h1-8,12,15,18H/p+1 |
| InChIKey | JWZMBHPSZLHIJD-UHFFFAOYSA-O |
| XLogP | 1.46 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|