C13H11N3O2 — CID 4670743
3-hydroxy-2-pyridin-2-yl-1,2-dihydroquinazolin-4-one (PubChem CID 4670743) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 3-hydroxy-2-pyridin-2-yl-1,2-dihydroquinazolin-4-one.
| Compound Name | 3-hydroxy-2-pyridin-2-yl-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 4670743 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 3-hydroxy-2-pyridin-2-yl-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2NC(c2ccccn2)N1O |
| InChI | InChI=1S/C13H11N3O2/c17-13-9-5-1-2-6-10(9)15-12(16(13)18)11-7-3-4-8-14-11/h1-8,12,15,18H |
| InChIKey | PPDQQHXBKCJWAQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|