C20H20Cl3N3O3S — CID 3451830
3-piperidin-1-ylsulfonyl-N-[1-(2,3,4-trichlorophenyl)ethylideneamino]benzamide (PubChem CID 3451830) has the molecular formula C20H20Cl3N3O3S and a molecular weight of 488.82 g/mol. Its IUPAC name is 3-piperidin-1-ylsulfonyl-N-[1-(2,3,4-trichlorophenyl)ethylideneamino]benzamide.
| Compound Name | 3-piperidin-1-ylsulfonyl-N-[1-(2,3,4-trichlorophenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 3451830 |
| Molecular Formula | C20H20Cl3N3O3S |
| Molecular Weight | 488.82 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | 3-piperidin-1-ylsulfonyl-N-[1-(2,3,4-trichlorophenyl)ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1cccc(S(=O)(=O)N2CCCCC2)c1)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C20H20Cl3N3O3S/c1-13(16-8-9-17(21)19(23)18(16)22)24-25-20(27)14-6-5-7-15(12-14)30(28,29)26-10-3-2-4-11-26/h5-9,12H,2-4,10-11H2,1H3,(H,25,27) |
| InChIKey | WDAHMZIJQVAMRJ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.82 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|