C15H20N2O4S2 — CID 34523338
(1R)-1-(furan-2-yl)-2-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]ethanol (PubChem CID 34523338) has the molecular formula C15H20N2O4S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is (1R)-1-(furan-2-yl)-2-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]ethanol.
| Compound Name | (1R)-1-(furan-2-yl)-2-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 34523338 |
| Molecular Formula | C15H20N2O4S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | (1R)-1-(furan-2-yl)-2-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]ethanol |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C[C@@H](O)c3ccco3)CC2)s1 |
| InChI | InChI=1S/C15H20N2O4S2/c1-12-4-5-15(22-12)23(19,20)17-8-6-16(7-9-17)11-13(18)14-3-2-10-21-14/h2-5,10,13,18H,6-9,11H2,1H3/t13-/m1/s1 |
| InChIKey | BCMPBXRXOLWSJZ-CYBMUJFWSA-N |
| XLogP | 1.69 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |