C21H19F3N6O3S — CID 3452366
N-[3-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-[1,2,4]triazolo[4,3-b][1,2,4]triazol-7-yl]-1-(3,4,5-trimethoxyphenyl)methanimine (PubChem CID 3452366) has the molecular formula C21H19F3N6O3S and a molecular weight of 492.48 g/mol. Its IUPAC name is N-[3-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-[1,2,4]triazolo[4,3-b][1,2,4]triazol-7-yl]-1-(3,4,5-trimethoxyphenyl)methanimine.
| Compound Name | N-[3-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-[1,2,4]triazolo[4,3-b][1,2,4]triazol-7-yl]-1-(3,4,5-trimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 3452366 |
| Molecular Formula | C21H19F3N6O3S |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | N-[3-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-[1,2,4]triazolo[4,3-b][1,2,4]triazol-7-yl]-1-(3,4,5-trimethoxyphenyl)methanimine |
| SMILES | COc1cc(C=Nn2cnn3c(SCc4cccc(C(F)(F)F)c4)nnc23)cc(OC)c1OC |
| InChI | InChI=1S/C21H19F3N6O3S/c1-31-16-8-14(9-17(32-2)18(16)33-3)10-25-29-12-26-30-19(29)27-28-20(30)34-11-13-5-4-6-15(7-13)21(22,23)24/h4-10,12H,11H2,1-3H3 |
| InChIKey | UMPRKHHNQCWTOF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 88.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|