C22H33N3O4 — CID 34525393
(6S,10S)-3-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-6,10-dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 34525393) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is (6S,10S)-3-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-6,10-dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (6S,10S)-3-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-6,10-dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 34525393 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | (6S,10S)-3-[[2-(3,4-dimethoxyphenyl)ethyl-methylamino]methyl]-6,10-dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | COc1ccc(CCN(C)CN2C(=O)NC3(C2=O)[C@@H](C)CCC[C@@H]3C)cc1OC |
| InChI | InChI=1S/C22H33N3O4/c1-15-7-6-8-16(2)22(15)20(26)25(21(27)23-22)14-24(3)12-11-17-9-10-18(28-4)19(13-17)29-5/h9-10,13,15-16H,6-8,11-12,14H2,1-5H3,(H,23,27)/t15-,16-/m0/s1 |
| InChIKey | JGWMQHPYHIRAPM-HOTGVXAUSA-N |
| XLogP | 2.88 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|