C22H18N2O7S — CID 3456587
methyl 2-[2-(furan-2-yl)-3-[hydroxy-(4-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 3456587) has the molecular formula C22H18N2O7S and a molecular weight of 454.46 g/mol. Its IUPAC name is methyl 2-[2-(furan-2-yl)-3-[hydroxy-(4-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[2-(furan-2-yl)-3-[hydroxy-(4-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 3456587 |
| Molecular Formula | C22H18N2O7S |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | methyl 2-[2-(furan-2-yl)-3-[hydroxy-(4-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3ccc(OC)cc3)C2c2ccco2)nc1C |
| InChI | InChI=1S/C22H18N2O7S/c1-11-19(21(28)30-3)32-22(23-11)24-16(14-5-4-10-31-14)15(18(26)20(24)27)17(25)12-6-8-13(29-2)9-7-12/h4-10,16,25H,1-3H3 |
| InChIKey | ISTARRFRYKFZAR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 119.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|