C25H22N2O7S — CID 3629416
ethyl 2-[2-(furan-2-yl)-3-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 3629416) has the molecular formula C25H22N2O7S and a molecular weight of 494.53 g/mol. Its IUPAC name is ethyl 2-[2-(furan-2-yl)-3-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[2-(furan-2-yl)-3-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 3629416 |
| Molecular Formula | C25H22N2O7S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | ethyl 2-[2-(furan-2-yl)-3-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOc1ccc(C(O)=C2C(=O)C(=O)N(c3nc(C)c(C(=O)OCC)s3)C2c2ccco2)cc1 |
| InChI | InChI=1S/C25H22N2O7S/c1-4-12-33-16-10-8-15(9-11-16)20(28)18-19(17-7-6-13-34-17)27(23(30)21(18)29)25-26-14(3)22(35-25)24(31)32-5-2/h4,6-11,13,19,28H,1,5,12H2,2-3H3 |
| InChIKey | HLHQSQKMAOTZRQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 119.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|