C27H24N2O7S — CID 98189593
ethyl 2-[(2R,3E)-2-(3-hydroxyphenyl)-3-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 98189593) has the molecular formula C27H24N2O7S and a molecular weight of 520.56 g/mol. Its IUPAC name is ethyl 2-[(2R,3E)-2-(3-hydroxyphenyl)-3-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(2R,3E)-2-(3-hydroxyphenyl)-3-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 98189593 |
| Molecular Formula | C27H24N2O7S |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | ethyl 2-[(2R,3E)-2-(3-hydroxyphenyl)-3-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOc1ccc(/C(O)=C2\C(=O)C(=O)N(c3nc(C)c(C(=O)OCC)s3)[C@@H]2c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C27H24N2O7S/c1-4-13-36-19-11-9-16(10-12-19)22(31)20-21(17-7-6-8-18(30)14-17)29(25(33)23(20)32)27-28-15(3)24(37-27)26(34)35-5-2/h4,6-12,14,21,30-31H,1,5,13H2,2-3H3/b22-20+/t21-/m1/s1 |
| InChIKey | JJRYOAFPEGKDEB-JBCNATCCSA-N |
| XLogP | 4.52 |
| TPSA | 126.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|