C26H23N3O6S — CID 3755256
ethyl 2-[4-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 3755256) has the molecular formula C26H23N3O6S and a molecular weight of 505.55 g/mol. Its IUPAC name is ethyl 2-[4-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[4-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 3755256 |
| Molecular Formula | C26H23N3O6S |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | ethyl 2-[4-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOc1ccc(C(O)=C2C(=O)C(=O)N(c3nc(C)c(C(=O)OCC)s3)C2c2cccnc2)cc1 |
| InChI | InChI=1S/C26H23N3O6S/c1-4-13-35-18-10-8-16(9-11-18)21(30)19-20(17-7-6-12-27-14-17)29(24(32)22(19)31)26-28-15(3)23(36-26)25(33)34-5-2/h4,6-12,14,20,30H,1,5,13H2,2-3H3 |
| InChIKey | YHTKOSCPDJXZJB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 118.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|