C20H20BrN3OS — CID 34566133
3-benzyl-5-[(3-bromo-4-methoxyphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 34566133) has the molecular formula C20H20BrN3OS and a molecular weight of 430.37 g/mol. Its IUPAC name is 3-benzyl-5-[(3-bromo-4-methoxyphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-benzyl-5-[(3-bromo-4-methoxyphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 34566133 |
| Molecular Formula | C20H20BrN3OS |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 3-benzyl-5-[(3-bromo-4-methoxyphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(Cc2ccccc2)nnc1SCc1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C20H20BrN3OS/c1-3-11-24-19(13-15-7-5-4-6-8-15)22-23-20(24)26-14-16-9-10-18(25-2)17(21)12-16/h3-10,12H,1,11,13-14H2,2H3 |
| InChIKey | QDWOKDYVYYIVGH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|