C14H7F12NO — CID 3457298
1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[(4-fluorophenyl)methyl]cyclohexane-1-carboxamide (PubChem CID 3457298) has the molecular formula C14H7F12NO and a molecular weight of 433.19 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[(4-fluorophenyl)methyl]cyclohexane-1-carboxamide.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[(4-fluorophenyl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 3457298 |
| Molecular Formula | C14H7F12NO |
| Molecular Weight | 433.19 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[(4-fluorophenyl)methyl]cyclohexane-1-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14H7F12NO/c15-7-3-1-6(2-4-7)5-27-8(28)9(16)10(17,18)12(21,22)14(25,26)13(23,24)11(9,19)20/h1-4H,5H2,(H,27,28) |
| InChIKey | ISLDVTLZUNBUJG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.19 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|