C12H12FNO4 — CID 115184975
3-[(4-fluorophenyl)methylcarbamoyl]oxetane-3-carboxylic acid (PubChem CID 115184975) has the molecular formula C12H12FNO4 and a molecular weight of 253.23 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methylcarbamoyl]oxetane-3-carboxylic acid.
| Compound Name | 3-[(4-fluorophenyl)methylcarbamoyl]oxetane-3-carboxylic acid |
|---|---|
| PubChem CID | 115184975 |
| Molecular Formula | C12H12FNO4 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 3-[(4-fluorophenyl)methylcarbamoyl]oxetane-3-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)NCc2ccc(F)cc2)COC1 |
| InChI | InChI=1S/C12H12FNO4/c13-9-3-1-8(2-4-9)5-14-10(15)12(11(16)17)6-18-7-12/h1-4H,5-7H2,(H,14,15)(H,16,17) |
| InChIKey | USBGZBULNPIJGR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|