C25H28F2N2O3 — CID 3461184
N-[1-(1-adamantyl)propan-2-ylideneamino]-5-[(2,4-difluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 3461184) has the molecular formula C25H28F2N2O3 and a molecular weight of 442.51 g/mol. Its IUPAC name is N-[1-(1-adamantyl)propan-2-ylideneamino]-5-[(2,4-difluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-(1-adamantyl)propan-2-ylideneamino]-5-[(2,4-difluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3461184 |
| Molecular Formula | C25H28F2N2O3 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | N-[1-(1-adamantyl)propan-2-ylideneamino]-5-[(2,4-difluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | CC(CC12CC3CC(CC(C3)C1)C2)=NNC(=O)c1ccc(COc2ccc(F)cc2F)o1 |
| InChI | InChI=1S/C25H28F2N2O3/c1-15(10-25-11-16-6-17(12-25)8-18(7-16)13-25)28-29-24(30)23-5-3-20(32-23)14-31-22-4-2-19(26)9-21(22)27/h2-5,9,16-18H,6-8,10-14H2,1H3,(H,29,30) |
| InChIKey | JGGIHDRHIKYGDW-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|