C10H9N5S — CID 3464456
4-(benzotriazol-1-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 3464456) has the molecular formula C10H9N5S and a molecular weight of 231.28 g/mol. Its IUPAC name is 4-(benzotriazol-1-ylmethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(benzotriazol-1-ylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 3464456 |
| Molecular Formula | C10H9N5S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 4-(benzotriazol-1-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(Cn2nnc3ccccc32)cs1 |
| InChI | InChI=1S/C10H9N5S/c11-10-12-7(6-16-10)5-15-9-4-2-1-3-8(9)13-14-15/h1-4,6H,5H2,(H2,11,12) |
| InChIKey | HQLHYOYQZARXPG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |