C18H19FN4O — CID 3465458
4-[5-(2-fluorophenyl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]aniline (PubChem CID 3465458) has the molecular formula C18H19FN4O and a molecular weight of 326.38 g/mol. Its IUPAC name is 4-[5-(2-fluorophenyl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]aniline.
| Compound Name | 4-[5-(2-fluorophenyl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]aniline |
|---|---|
| PubChem CID | 3465458 |
| Molecular Formula | C18H19FN4O |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 4-[5-(2-fluorophenyl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]aniline |
| SMILES | CC(C)COc1nc(-c2ccccc2F)n(-c2ccc(N)cc2)n1 |
| InChI | InChI=1S/C18H19FN4O/c1-12(2)11-24-18-21-17(15-5-3-4-6-16(15)19)23(22-18)14-9-7-13(20)8-10-14/h3-10,12H,11,20H2,1-2H3 |
| InChIKey | SOHWFSWYKKCUCG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|