C27H24FN5O4 — CID 6107960
(E)-N-[4-[5-(2-fluorophenyl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]phenyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 6107960) has the molecular formula C27H24FN5O4 and a molecular weight of 501.52 g/mol. Its IUPAC name is (E)-N-[4-[5-(2-fluorophenyl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]phenyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[5-(2-fluorophenyl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]phenyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6107960 |
| Molecular Formula | C27H24FN5O4 |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | (E)-N-[4-[5-(2-fluorophenyl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]phenyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CC(C)COc1nc(-c2ccccc2F)n(-c2ccc(NC(=O)/C=C/c3ccc([N+](=O)[O-])cc3)cc2)n1 |
| InChI | InChI=1S/C27H24FN5O4/c1-18(2)17-37-27-30-26(23-5-3-4-6-24(23)28)32(31-27)21-14-10-20(11-15-21)29-25(34)16-9-19-7-12-22(13-8-19)33(35)36/h3-16,18H,17H2,1-2H3,(H,29,34)/b16-9+ |
| InChIKey | NSMBTZGUGBUZJY-CXUHLZMHSA-N |
| XLogP | 5.67 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|