C23H19N3O3 — CID 34656833
2-(2-cyanophenyl)-N'-[2-(3-methylphenoxy)acetyl]benzohydrazide (PubChem CID 34656833) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-(2-cyanophenyl)-N'-[2-(3-methylphenoxy)acetyl]benzohydrazide.
| Compound Name | 2-(2-cyanophenyl)-N'-[2-(3-methylphenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 34656833 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-(2-cyanophenyl)-N'-[2-(3-methylphenoxy)acetyl]benzohydrazide |
| SMILES | Cc1cccc(OCC(=O)NNC(=O)c2ccccc2-c2ccccc2C#N)c1 |
| InChI | InChI=1S/C23H19N3O3/c1-16-7-6-9-18(13-16)29-15-22(27)25-26-23(28)21-12-5-4-11-20(21)19-10-3-2-8-17(19)14-24/h2-13H,15H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | VDFJIDRCXILGJN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|