C27H33N3O4 — CID 34668566
[2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate (PubChem CID 34668566) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is [2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate.
| Compound Name | [2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 34668566 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | [2-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate |
| SMILES | COc1ccc(CN(C(=O)COC(=O)/C(C#N)=C/c2cc(C)n(CC(C)C)c2C)C2CC2)cc1 |
| InChI | InChI=1S/C27H33N3O4/c1-18(2)15-29-19(3)12-22(20(29)4)13-23(14-28)27(32)34-17-26(31)30(24-8-9-24)16-21-6-10-25(33-5)11-7-21/h6-7,10-13,18,24H,8-9,15-17H2,1-5H3/b23-13+ |
| InChIKey | MTDMKVSGIXZLKL-YDZHTSKRSA-N |
| XLogP | 4.41 |
| TPSA | 84.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|