C28H34N4O2 — CID 55557624
4-[[[2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoyl]-cyclopropylamino]methyl]-N-cyclopropylbenzamide (PubChem CID 55557624) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 4-[[[2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoyl]-cyclopropylamino]methyl]-N-cyclopropylbenzamide.
| Compound Name | 4-[[[2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoyl]-cyclopropylamino]methyl]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 55557624 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 4-[[[2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoyl]-cyclopropylamino]methyl]-N-cyclopropylbenzamide |
| SMILES | Cc1cc(C=C(C#N)C(=O)N(Cc2ccc(C(=O)NC3CC3)cc2)C2CC2)c(C)n1CC(C)C |
| InChI | InChI=1S/C28H34N4O2/c1-18(2)16-31-19(3)13-23(20(31)4)14-24(15-29)28(34)32(26-11-12-26)17-21-5-7-22(8-6-21)27(33)30-25-9-10-25/h5-8,13-14,18,25-26H,9-12,16-17H2,1-4H3,(H,30,33) |
| InChIKey | ZZUXZBSEKODCIB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|