C24H28FN3O3 — CID 7915265
[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate (PubChem CID 7915265) has the molecular formula C24H28FN3O3 and a molecular weight of 425.50 g/mol. Its IUPAC name is [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate.
| Compound Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7915265 |
| Molecular Formula | C24H28FN3O3 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)OCC(=O)NCCc2ccc(F)cc2)c(C)n1CC(C)C |
| InChI | InChI=1S/C24H28FN3O3/c1-16(2)14-28-17(3)11-20(18(28)4)12-21(13-26)24(30)31-15-23(29)27-10-9-19-5-7-22(25)8-6-19/h5-8,11-12,16H,9-10,14-15H2,1-4H3,(H,27,29)/b21-12+ |
| InChIKey | KICNMDBNUXLUQN-CIAFOILYSA-N |
| XLogP | 3.71 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|