C26H31FN4O3 — CID 31231505
[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate (PubChem CID 31231505) has the molecular formula C26H31FN4O3 and a molecular weight of 466.56 g/mol. Its IUPAC name is [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate.
| Compound Name | [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 31231505 |
| Molecular Formula | C26H31FN4O3 |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)OCC(=O)N2CCN(c3ccc(F)cc3)CC2)c(C)n1CC(C)C |
| InChI | InChI=1S/C26H31FN4O3/c1-18(2)16-31-19(3)13-21(20(31)4)14-22(15-28)26(33)34-17-25(32)30-11-9-29(10-12-30)24-7-5-23(27)6-8-24/h5-8,13-14,18H,9-12,16-17H2,1-4H3/b22-14+ |
| InChIKey | PUEJVPUDYLKWMU-HYARGMPZSA-N |
| XLogP | 3.70 |
| TPSA | 78.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|