C20H23BrFN3O3 — CID 34693159
3-(N-[2-[(5-bromo-2-methoxyphenyl)methyl-methylamino]acetyl]-4-fluoroanilino)propanamide (PubChem CID 34693159) has the molecular formula C20H23BrFN3O3 and a molecular weight of 452.32 g/mol. Its IUPAC name is 3-(N-[2-[(5-bromo-2-methoxyphenyl)methyl-methylamino]acetyl]-4-fluoroanilino)propanamide.
| Compound Name | 3-(N-[2-[(5-bromo-2-methoxyphenyl)methyl-methylamino]acetyl]-4-fluoroanilino)propanamide |
|---|---|
| PubChem CID | 34693159 |
| Molecular Formula | C20H23BrFN3O3 |
| Molecular Weight | 452.32 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 3-(N-[2-[(5-bromo-2-methoxyphenyl)methyl-methylamino]acetyl]-4-fluoroanilino)propanamide |
| SMILES | COc1ccc(Br)cc1CN(C)CC(=O)N(CCC(N)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H23BrFN3O3/c1-24(12-14-11-15(21)3-8-18(14)28-2)13-20(27)25(10-9-19(23)26)17-6-4-16(22)5-7-17/h3-8,11H,9-10,12-13H2,1-2H3,(H2,23,26) |
| InChIKey | KVBNUUGBXJUJCH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |