C16H9Cl2FN4S — CID 3469744
6-(3,4-dichlorophenyl)-3-(3-fluorophenyl)-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 3469744) has the molecular formula C16H9Cl2FN4S and a molecular weight of 379.25 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)-3-(3-fluorophenyl)-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 6-(3,4-dichlorophenyl)-3-(3-fluorophenyl)-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 3469744 |
| Molecular Formula | C16H9Cl2FN4S |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 6-(3,4-dichlorophenyl)-3-(3-fluorophenyl)-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | Fc1cccc(-c2nnc3n2NC(c2ccc(Cl)c(Cl)c2)=CS3)c1 |
| InChI | InChI=1S/C16H9Cl2FN4S/c17-12-5-4-9(7-13(12)18)14-8-24-16-21-20-15(23(16)22-14)10-2-1-3-11(19)6-10/h1-8,22H |
| InChIKey | HUBXKRUNZQDPPZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |