C21H14Cl2N4OS — CID 5056837
3-benzyl-6-[5-(3,4-dichlorophenyl)furan-2-yl]-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 5056837) has the molecular formula C21H14Cl2N4OS and a molecular weight of 441.34 g/mol. Its IUPAC name is 3-benzyl-6-[5-(3,4-dichlorophenyl)furan-2-yl]-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 3-benzyl-6-[5-(3,4-dichlorophenyl)furan-2-yl]-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 5056837 |
| Molecular Formula | C21H14Cl2N4OS |
| Molecular Weight | 441.34 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 3-benzyl-6-[5-(3,4-dichlorophenyl)furan-2-yl]-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | Clc1ccc(-c2ccc(C3=CSc4nnc(Cc5ccccc5)n4N3)o2)cc1Cl |
| InChI | InChI=1S/C21H14Cl2N4OS/c22-15-7-6-14(11-16(15)23)18-8-9-19(28-18)17-12-29-21-25-24-20(27(21)26-17)10-13-4-2-1-3-5-13/h1-9,11-12,26H,10H2 |
| InChIKey | DOLNLKTXRVFAGQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.34 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |