C20H22ClN3OS — CID 3470392
1-adamantyl-[4-amino-2-(3-chloroanilino)-1,3-thiazol-5-yl]methanone (PubChem CID 3470392) has the molecular formula C20H22ClN3OS and a molecular weight of 387.94 g/mol. Its IUPAC name is 1-adamantyl-[4-amino-2-(3-chloroanilino)-1,3-thiazol-5-yl]methanone.
| Compound Name | 1-adamantyl-[4-amino-2-(3-chloroanilino)-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 3470392 |
| Molecular Formula | C20H22ClN3OS |
| Molecular Weight | 387.94 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 1-adamantyl-[4-amino-2-(3-chloroanilino)-1,3-thiazol-5-yl]methanone |
| SMILES | Nc1nc(Nc2cccc(Cl)c2)sc1C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H22ClN3OS/c21-14-2-1-3-15(7-14)23-19-24-18(22)16(26-19)17(25)20-8-11-4-12(9-20)6-13(5-11)10-20/h1-3,7,11-13H,4-6,8-10,22H2,(H,23,24) |
| InChIKey | WIOQQMLUOLXTIQ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.94 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |