C18H19ClN2O2S — CID 3470758
4-chloro-N-[(4-phenylcyclohexylidene)amino]benzenesulfonamide (PubChem CID 3470758) has the molecular formula C18H19ClN2O2S and a molecular weight of 362.88 g/mol. Its IUPAC name is 4-chloro-N-[(4-phenylcyclohexylidene)amino]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(4-phenylcyclohexylidene)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 3470758 |
| Molecular Formula | C18H19ClN2O2S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 4-chloro-N-[(4-phenylcyclohexylidene)amino]benzenesulfonamide |
| SMILES | O=S(=O)(NN=C1CCC(c2ccccc2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19ClN2O2S/c19-16-8-12-18(13-9-16)24(22,23)21-20-17-10-6-15(7-11-17)14-4-2-1-3-5-14/h1-5,8-9,12-13,15,21H,6-7,10-11H2/b20-17- |
| InChIKey | QCOAOIJSHIGQCM-JZJYNLBNSA-N |
| XLogP | 4.33 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|