C21H15N5O2S2 — CID 3472887
2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-1-phenothiazin-10-ylethanone (PubChem CID 3472887) has the molecular formula C21H15N5O2S2 and a molecular weight of 433.52 g/mol. Its IUPAC name is 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-1-phenothiazin-10-ylethanone.
| Compound Name | 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-1-phenothiazin-10-ylethanone |
|---|---|
| PubChem CID | 3472887 |
| Molecular Formula | C21H15N5O2S2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-1-phenothiazin-10-ylethanone |
| SMILES | O=C(CSc1nnnn1-c1ccc(O)cc1)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C21H15N5O2S2/c27-15-11-9-14(10-12-15)26-21(22-23-24-26)29-13-20(28)25-16-5-1-3-7-18(16)30-19-8-4-2-6-17(19)25/h1-12,27H,13H2 |
| InChIKey | HIVOMLAFMRNJPY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |