C19H17BrN2O3 — CID 34737784
(E)-1-[(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-3-(5-bromofuran-2-yl)prop-2-en-1-one (PubChem CID 34737784) has the molecular formula C19H17BrN2O3 and a molecular weight of 401.26 g/mol. Its IUPAC name is (E)-1-[(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-3-(5-bromofuran-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-3-(5-bromofuran-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 34737784 |
| Molecular Formula | C19H17BrN2O3 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | (E)-1-[(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-3-(5-bromofuran-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Br)o1)N1CCC[C@H](c2nc3ccccc3o2)C1 |
| InChI | InChI=1S/C19H17BrN2O3/c20-17-9-7-14(24-17)8-10-18(23)22-11-3-4-13(12-22)19-21-15-5-1-2-6-16(15)25-19/h1-2,5-10,13H,3-4,11-12H2/b10-8+/t13-/m0/s1 |
| InChIKey | PSJLUKQURRJZRD-FROQITRMSA-N |
| XLogP | 4.60 |
| TPSA | 59.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|