C18H27N3OS — CID 3477975
1-(1-acetylpiperidin-4-yl)-3-(4-methylphenyl)-1-propan-2-ylthiourea (PubChem CID 3477975) has the molecular formula C18H27N3OS and a molecular weight of 333.50 g/mol. Its IUPAC name is 1-(1-acetylpiperidin-4-yl)-3-(4-methylphenyl)-1-propan-2-ylthiourea.
| Compound Name | 1-(1-acetylpiperidin-4-yl)-3-(4-methylphenyl)-1-propan-2-ylthiourea |
|---|---|
| PubChem CID | 3477975 |
| Molecular Formula | C18H27N3OS |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 1-(1-acetylpiperidin-4-yl)-3-(4-methylphenyl)-1-propan-2-ylthiourea |
| SMILES | CC(=O)N1CCC(N(C(=S)Nc2ccc(C)cc2)C(C)C)CC1 |
| InChI | InChI=1S/C18H27N3OS/c1-13(2)21(17-9-11-20(12-10-17)15(4)22)18(23)19-16-7-5-14(3)6-8-16/h5-8,13,17H,9-12H2,1-4H3,(H,19,23) |
| InChIKey | HKPKNFORKOLCDI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|